C31H42N4OS — CID 25130817
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-(3-methylbutyl)amino]ethyl]cyclohexyl]naphthalene-2-carboxamide (PubChem CID 25130817) has the molecular formula C31H42N4OS and a molecular weight of 518.77 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-(3-methylbutyl)amino]ethyl]cyclohexyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-(3-methylbutyl)amino]ethyl]cyclohexyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25130817 |
| Molecular Formula | C31H42N4OS |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-(3-methylbutyl)amino]ethyl]cyclohexyl]naphthalene-2-carboxamide |
| SMILES | CC(C)CCN(CCC1CCC(NC(=O)c2ccc3ccccc3c2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C31H42N4OS/c1-21(2)15-17-35(27-13-14-28-29(20-27)37-31(32)34-28)18-16-22-7-11-26(12-8-22)33-30(36)25-10-9-23-5-3-4-6-24(23)19-25/h3-6,9-10,19,21-22,26-27H,7-8,11-18,20H2,1-2H3,(H2,32,34)(H,33,36)/t22?,26?,27-/m0/s1 |
| InChIKey | OLVLMWXYVZNIPP-DFTBRHRKSA-N |
| XLogP | 6.46 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |