About N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide
N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 25130826) has the molecular formula C10H13BrN2O2S
and a molecular weight of 305.20 g/mol. Its IUPAC name is N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| PubChem CID | 25130826 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncc(C(=O)CBr)s1 |
| InChI | InChI=1S/C10H13BrN2O2S/c1-10(2,3)8(15)13-9-12-5-7(16-9)6(14)4-11/h5H,4H2,1-3H3,(H,12,13,15) |
| InChIKey | BFIQLZUQBLETDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (CID 25130826) is N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1ncc(C(=O)CBr)s1.
What is the InChIKey of N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide?
The InChIKey is BFIQLZUQBLETDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2S/c1-10(2,3)8(15)13-9-12-5-7(16-9)6(14)4-11/h5H,4H2,1-3H3,(H,12,13,15).
What are the key properties of N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide?
N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide has a molecular weight of 305.20 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 25130826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).