C19H29N5 — CID 25130896
6-N-benzyl-2-N,4-N-bis(2-methylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 25130896) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 6-N-benzyl-2-N,4-N-bis(2-methylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-benzyl-2-N,4-N-bis(2-methylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 25130896 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 6-N-benzyl-2-N,4-N-bis(2-methylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CNc1cc(NCc2ccccc2)nc(NCC(C)C)n1 |
| InChI | InChI=1S/C19H29N5/c1-14(2)11-20-17-10-18(21-13-16-8-6-5-7-9-16)24-19(23-17)22-12-15(3)4/h5-10,14-15H,11-13H2,1-4H3,(H3,20,21,22,23,24) |
| InChIKey | ZOQDUFOUNDLFCC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |