About 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine
4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine (PubChem CID 25130911) has the molecular formula C11H20N6
and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine |
| PubChem CID | 25130911 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2cc(N(C)C)nc(N)n2)CC1 |
| InChI | InChI=1S/C11H20N6/c1-15(2)9-8-10(14-11(12)13-9)17-6-4-16(3)5-7-17/h8H,4-7H2,1-3H3,(H2,12,13,14) |
| InChIKey | XDZWHHLMPCEUIV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine?
The IUPAC name of 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine (CID 25130911) is 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine?
The canonical SMILES for 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine is CN1CCN(c2cc(N(C)C)nc(N)n2)CC1.
What is the InChIKey of 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine?
The InChIKey is XDZWHHLMPCEUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N6/c1-15(2)9-8-10(14-11(12)13-9)17-6-4-16(3)5-7-17/h8H,4-7H2,1-3H3,(H2,12,13,14).
What are the key properties of 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine?
4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine has a molecular weight of 236.32 g/mol, XLogP of -0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-6-(4-methylpiperazin-1-yl)pyrimidine-2,4-diamine is sourced from PubChem (CID 25130911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).