C23H23N3O3 — CID 25131005
9-amino-2-cyclobutyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one (PubChem CID 25131005) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 9-amino-2-cyclobutyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one.
| Compound Name | 9-amino-2-cyclobutyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 25131005 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 9-amino-2-cyclobutyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one |
| SMILES | COc1ccc(OC)c(-c2cccc3c(N)c4c(nc23)CN(C2CCC2)C4=O)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-28-14-9-10-19(29-2)17(11-14)15-7-4-8-16-21(24)20-18(25-22(15)16)12-26(23(20)27)13-5-3-6-13/h4,7-11,13H,3,5-6,12H2,1-2H3,(H2,24,25) |
| InChIKey | IPRPEMNPDVAAOU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |