C24H36O5Si — CID 25131126
methyl (1'S,3'S,3'aR,6'aS)-5,5-dimethyl-2'-oxo-3'-prop-2-enyl-1'-(3-trimethylsilylprop-2-ynyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate (PubChem CID 25131126) has the molecular formula C24H36O5Si and a molecular weight of 432.63 g/mol. Its IUPAC name is methyl (1'S,3'S,3'aR,6'aS)-5,5-dimethyl-2'-oxo-3'-prop-2-enyl-1'-(3-trimethylsilylprop-2-ynyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate.
| Compound Name | methyl (1'S,3'S,3'aR,6'aS)-5,5-dimethyl-2'-oxo-3'-prop-2-enyl-1'-(3-trimethylsilylprop-2-ynyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 25131126 |
| Molecular Formula | C24H36O5Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | methyl (1'S,3'S,3'aR,6'aS)-5,5-dimethyl-2'-oxo-3'-prop-2-enyl-1'-(3-trimethylsilylprop-2-ynyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
| SMILES | C=CC[C@@H]1C(=O)[C@@](CC#C[Si](C)(C)C)(C(=O)OC)[C@H]2CC3(C[C@@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C24H36O5Si/c1-8-10-17-18-13-23(28-15-22(2,3)16-29-23)14-19(18)24(20(17)25,21(26)27-4)11-9-12-30(5,6)7/h8,17-19H,1,10-11,13-16H2,2-7H3/t17-,18-,19-,24-/m0/s1 |
| InChIKey | HWVQWWFJXRTMBL-LYXWCMDISA-N |
| XLogP | 3.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|