C30H40N4OS — CID 25131136
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-butylamino]ethyl]cyclohexyl]naphthalene-2-carboxamide (PubChem CID 25131136) has the molecular formula C30H40N4OS and a molecular weight of 504.74 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-butylamino]ethyl]cyclohexyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-butylamino]ethyl]cyclohexyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25131136 |
| Molecular Formula | C30H40N4OS |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-butylamino]ethyl]cyclohexyl]naphthalene-2-carboxamide |
| SMILES | CCCCN(CCC1CCC(NC(=O)c2ccc3ccccc3c2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C30H40N4OS/c1-2-3-17-34(26-14-15-27-28(20-26)36-30(31)33-27)18-16-21-8-12-25(13-9-21)32-29(35)24-11-10-22-6-4-5-7-23(22)19-24/h4-7,10-11,19,21,25-26H,2-3,8-9,12-18,20H2,1H3,(H2,31,33)(H,32,35)/t21?,25?,26-/m0/s1 |
| InChIKey | XLKUVKBPRSKDBI-FNEQHPHYSA-N |
| XLogP | 6.22 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |