C21H28O5 — CID 25131453
methyl (1'S,2'S,6'R,7'S)-10'-ethenyl-5,5-dimethyl-12'-oxospiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate (PubChem CID 25131453) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (1'S,2'S,6'R,7'S)-10'-ethenyl-5,5-dimethyl-12'-oxospiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate.
| Compound Name | methyl (1'S,2'S,6'R,7'S)-10'-ethenyl-5,5-dimethyl-12'-oxospiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate |
|---|---|
| PubChem CID | 25131453 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (1'S,2'S,6'R,7'S)-10'-ethenyl-5,5-dimethyl-12'-oxospiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate |
| SMILES | C=CC1=CC[C@@H]2C(=O)[C@](C(=O)OC)(C1)[C@H]1CC3(C[C@@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C21H28O5/c1-5-13-6-7-14-15-9-20(25-11-19(2,3)12-26-20)10-16(15)21(8-13,17(14)22)18(23)24-4/h5-6,14-16H,1,7-12H2,2-4H3/t14-,15-,16-,21-/m0/s1 |
| InChIKey | AOCHKJYQVGHHNE-OSAWLIQMSA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|