C19H26O5 — CID 25131456
methyl (1'R,3'aS,6'aR)-1'-but-2-ynyl-5,5-dimethyl-2'-oxospiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate (PubChem CID 25131456) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is methyl (1'R,3'aS,6'aR)-1'-but-2-ynyl-5,5-dimethyl-2'-oxospiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate.
| Compound Name | methyl (1'R,3'aS,6'aR)-1'-but-2-ynyl-5,5-dimethyl-2'-oxospiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 25131456 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | methyl (1'R,3'aS,6'aR)-1'-but-2-ynyl-5,5-dimethyl-2'-oxospiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
| SMILES | CC#CC[C@]1(C(=O)OC)C(=O)C[C@H]2CC3(C[C@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C19H26O5/c1-5-6-7-19(16(21)22-4)14-10-18(9-13(14)8-15(19)20)23-11-17(2,3)12-24-18/h13-14H,7-12H2,1-4H3/t13-,14+,19+/m0/s1 |
| InChIKey | NPALWSMJCQXQOM-IQUTYRLHSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|