About 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol
6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol (PubChem CID 25131861) has the molecular formula C18H14O4S
and a molecular weight of 326.37 g/mol. Its IUPAC name is 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol.
Molecular Properties
| Compound Name | 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol |
| PubChem CID | 25131861 |
| Molecular Formula | C18H14O4S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol |
| SMILES | COc1cc(/C=C\c2cc(O)c3ccsc3c2)cc2c1OCO2 |
| InChI | InChI=1S/C18H14O4S/c1-20-15-7-12(8-16-18(15)22-10-21-16)3-2-11-6-14(19)13-4-5-23-17(13)9-11/h2-9,19H,10H2,1H3/b3-2- |
| InChIKey | NCFLKWNDPPVQKH-IHWYPQMZSA-N |
| XLogP | 4.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol?
The IUPAC name of 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol (CID 25131861) is 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol.
What is the SMILES notation for 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol?
The canonical SMILES for 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol is COc1cc(/C=C\c2cc(O)c3ccsc3c2)cc2c1OCO2.
What is the InChIKey of 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol?
The InChIKey is NCFLKWNDPPVQKH-IHWYPQMZSA-N. The full InChI is InChI=1S/C18H14O4S/c1-20-15-7-12(8-16-18(15)22-10-21-16)3-2-11-6-14(19)13-4-5-23-17(13)9-11/h2-9,19H,10H2,1H3/b3-2-.
What are the key properties of 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol?
6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol has a molecular weight of 326.37 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]-1-benzothiophen-4-ol is sourced from PubChem (CID 25131861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).