C22H23N5 — CID 25132198
6-N-(naphthalen-2-ylmethyl)-6-N-propylquinazoline-2,4,6-triamine (PubChem CID 25132198) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 6-N-(naphthalen-2-ylmethyl)-6-N-propylquinazoline-2,4,6-triamine.
| Compound Name | 6-N-(naphthalen-2-ylmethyl)-6-N-propylquinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 25132198 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 6-N-(naphthalen-2-ylmethyl)-6-N-propylquinazoline-2,4,6-triamine |
| SMILES | CCCN(Cc1ccc2ccccc2c1)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C22H23N5/c1-2-11-27(14-15-7-8-16-5-3-4-6-17(16)12-15)18-9-10-20-19(13-18)21(23)26-22(24)25-20/h3-10,12-13H,2,11,14H2,1H3,(H4,23,24,25,26) |
| InChIKey | KRNZWFKAPBBIRZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |