C13H22O4 — CID 25132202
butyl (3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octane-7-carboxylate (PubChem CID 25132202) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is butyl (3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octane-7-carboxylate.
| Compound Name | butyl (3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octane-7-carboxylate |
|---|---|
| PubChem CID | 25132202 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | butyl (3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octane-7-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@]2(CO2)CC(C)(C)O1 |
| InChI | InChI=1S/C13H22O4/c1-4-5-6-15-11(14)10-7-13(9-16-13)8-12(2,3)17-10/h10H,4-9H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | LWWZIJSAEQXATC-GXFFZTMASA-N |
| XLogP | 2.06 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|