C20H23N4+ — CID 25132222
N',N'-dimethyl-N-(5-methyl-10H-indolo[3,2-b]quinolin-5-ium-11-yl)ethane-1,2-diamine (PubChem CID 25132222) has the molecular formula C20H23N4+ and a molecular weight of 319.43 g/mol. Its IUPAC name is N',N'-dimethyl-N-(5-methyl-10H-indolo[3,2-b]quinolin-5-ium-11-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(5-methyl-10H-indolo[3,2-b]quinolin-5-ium-11-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 25132222 |
| Molecular Formula | C20H23N4+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N',N'-dimethyl-N-(5-methyl-10H-indolo[3,2-b]quinolin-5-ium-11-yl)ethane-1,2-diamine |
| SMILES | CN(C)CCNc1c2ccccc2[n+](C)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H22N4/c1-23(2)13-12-21-18-15-9-5-7-11-17(15)24(3)20-14-8-4-6-10-16(14)22-19(18)20/h4-11H,12-13H2,1-3H3,(H,21,22)/p+1 |
| InChIKey | LIGUVABQIBSCLO-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 34.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|