C18H10F9NO2 — CID 25132504
2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(2,2,2-trifluoroethyl)phenanthridin-6-one (PubChem CID 25132504) has the molecular formula C18H10F9NO2 and a molecular weight of 443.27 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(2,2,2-trifluoroethyl)phenanthridin-6-one.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(2,2,2-trifluoroethyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 25132504 |
| Molecular Formula | C18H10F9NO2 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(2,2,2-trifluoroethyl)phenanthridin-6-one |
| SMILES | O=c1c2ccccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C18H10F9NO2/c19-15(20,21)8-28-13-6-5-9(16(30,17(22,23)24)18(25,26)27)7-12(13)10-3-1-2-4-11(10)14(28)29/h1-7,30H,8H2 |
| InChIKey | QLZRAJAUJHVGPR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|