About 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride
4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride (PubChem CID 25132857) has the molecular formula C12H13BrClN3O
and a molecular weight of 330.61 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride |
| PubChem CID | 25132857 |
| Molecular Formula | C12H13BrClN3O |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride |
| SMILES | Cl.O=C(CCc1ccc(Br)cc1)Cn1cncn1 |
| InChI | InChI=1S/C12H12BrN3O.ClH/c13-11-4-1-10(2-5-11)3-6-12(17)7-16-9-14-8-15-16;/h1-2,4-5,8-9H,3,6-7H2;1H |
| InChIKey | STYVNYPZZPRRRU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride?
The IUPAC name of 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride (CID 25132857) is 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride.
What is the SMILES notation for 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride?
The canonical SMILES for 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride is Cl.O=C(CCc1ccc(Br)cc1)Cn1cncn1.
What is the InChIKey of 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride?
The InChIKey is STYVNYPZZPRRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN3O.ClH/c13-11-4-1-10(2-5-11)3-6-12(17)7-16-9-14-8-15-16;/h1-2,4-5,8-9H,3,6-7H2;1H.
What are the key properties of 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride?
4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride has a molecular weight of 330.61 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-1-(1,2,4-triazol-1-yl)butan-2-one;hydrochloride is sourced from PubChem (CID 25132857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).