About 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one
2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one (PubChem CID 25133010) has the molecular formula C20H10N2O2S3
and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one |
| PubChem CID | 25133010 |
| Molecular Formula | C20H10N2O2S3 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one |
| SMILES | O=c1sc(-c2ccc(-c3nc4ccccc4c(=O)s3)s2)nc2ccccc12 |
| InChI | InChI=1S/C20H10N2O2S3/c23-19-11-5-1-3-7-13(11)21-17(26-19)15-9-10-16(25-15)18-22-14-8-4-2-6-12(14)20(24)27-18/h1-10H |
| InChIKey | XLQYGCXXAKCLFT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one?
The IUPAC name of 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one (CID 25133010) is 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one.
What is the SMILES notation for 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one?
The canonical SMILES for 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one is O=c1sc(-c2ccc(-c3nc4ccccc4c(=O)s3)s2)nc2ccccc12.
What is the InChIKey of 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one?
The InChIKey is XLQYGCXXAKCLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10N2O2S3/c23-19-11-5-1-3-7-13(11)21-17(26-19)15-9-10-16(25-15)18-22-14-8-4-2-6-12(14)20(24)27-18/h1-10H.
What are the key properties of 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one?
2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one has a molecular weight of 406.51 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-oxo-3,1-benzothiazin-2-yl)thiophen-2-yl]-3,1-benzothiazin-4-one is sourced from PubChem (CID 25133010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).