C21H25NO7 — CID 25133238
oxalic acid;2-phenoxy-N-[[(2R,5R)-5-phenyl-1,4-dioxan-2-yl]methyl]ethanamine (PubChem CID 25133238) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is oxalic acid;2-phenoxy-N-[[(2R,5R)-5-phenyl-1,4-dioxan-2-yl]methyl]ethanamine.
| Compound Name | oxalic acid;2-phenoxy-N-[[(2R,5R)-5-phenyl-1,4-dioxan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 25133238 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | oxalic acid;2-phenoxy-N-[[(2R,5R)-5-phenyl-1,4-dioxan-2-yl]methyl]ethanamine |
| SMILES | O=C(O)C(=O)O.c1ccc(OCCNC[C@@H]2CO[C@H](c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C19H23NO3.C2H2O4/c1-3-7-16(8-4-1)19-15-22-18(14-23-19)13-20-11-12-21-17-9-5-2-6-10-17;3-1(4)2(5)6/h1-10,18-20H,11-15H2;(H,3,4)(H,5,6)/t18-,19+;/m1./s1 |
| InChIKey | QEUOPZWKWZMSLN-VOMIJIAVSA-N |
| XLogP | 1.97 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|