About tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate
tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 25133276) has the molecular formula C17H18BrFN2O2
and a molecular weight of 381.25 g/mol. Its IUPAC name is tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| PubChem CID | 25133276 |
| Molecular Formula | C17H18BrFN2O2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2(C#N)c1ccc(Br)cc1F |
| InChI | InChI=1S/C17H18BrFN2O2/c1-16(2,3)23-15(22)21-7-12-13(8-21)17(12,9-20)11-5-4-10(18)6-14(11)19/h4-6,12-13H,7-8H2,1-3H3/t12-,13+,17? |
| InChIKey | GLBOSHJIZNJMDS-MPYYAJLASA-N |
| XLogP | 3.85 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The IUPAC name of tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate (CID 25133276) is tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate.
What is the SMILES notation for tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The canonical SMILES for tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate is CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2(C#N)c1ccc(Br)cc1F.
What is the InChIKey of tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The InChIKey is GLBOSHJIZNJMDS-MPYYAJLASA-N. The full InChI is InChI=1S/C17H18BrFN2O2/c1-16(2,3)23-15(22)21-7-12-13(8-21)17(12,9-20)11-5-4-10(18)6-14(11)19/h4-6,12-13H,7-8H2,1-3H3/t12-,13+,17?.
What are the key properties of tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate?
tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate has a molecular weight of 381.25 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1R,5S)-6-(4-bromo-2-fluorophenyl)-6-cyano-3-azabicyclo[3.1.0]hexane-3-carboxylate is sourced from PubChem (CID 25133276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).