C17H11F8N3O2S — CID 25133536
(2S)-2-(3H-imidazo[4,5-c]pyridin-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)propane-1-thiol;2,2,2-trifluoroacetic acid (PubChem CID 25133536) has the molecular formula C17H11F8N3O2S and a molecular weight of 473.35 g/mol. Its IUPAC name is (2S)-2-(3H-imidazo[4,5-c]pyridin-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)propane-1-thiol;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-(3H-imidazo[4,5-c]pyridin-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)propane-1-thiol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25133536 |
| Molecular Formula | C17H11F8N3O2S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | (2S)-2-(3H-imidazo[4,5-c]pyridin-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)propane-1-thiol;2,2,2-trifluoroacetic acid |
| SMILES | Fc1c(F)c(F)c(C[C@H](CS)c2nc3ccncc3[nH]2)c(F)c1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H10F5N3S.C2HF3O2/c16-10-7(11(17)13(19)14(20)12(10)18)3-6(5-24)15-22-8-1-2-21-4-9(8)23-15;3-2(4,5)1(6)7/h1-2,4,6,24H,3,5H2,(H,22,23);(H,6,7)/t6-;/m1./s1 |
| InChIKey | ZGKXXPHBWRFKPZ-FYZOBXCZSA-N |
| XLogP | 4.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|