About (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 25133922) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one |
| PubChem CID | 25133922 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | C=CCOc1cc(OC)c(C(=O)/C=C/c2ccncc2)c(OCC=C)c1 |
| InChI | InChI=1S/C21H21NO4/c1-4-12-25-17-14-19(24-3)21(20(15-17)26-13-5-2)18(23)7-6-16-8-10-22-11-9-16/h4-11,14-15H,1-2,12-13H2,3H3/b7-6+ |
| InChIKey | HLVCZACFRHNBEH-VOTSOKGWSA-N |
| XLogP | 4.12 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one?
The IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one (CID 25133922) is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one.
What is the SMILES notation for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one?
The canonical SMILES for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one is C=CCOc1cc(OC)c(C(=O)/C=C/c2ccncc2)c(OCC=C)c1.
What is the InChIKey of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one?
The InChIKey is HLVCZACFRHNBEH-VOTSOKGWSA-N. The full InChI is InChI=1S/C21H21NO4/c1-4-12-25-17-14-19(24-3)21(20(15-17)26-13-5-2)18(23)7-6-16-8-10-22-11-9-16/h4-11,14-15H,1-2,12-13H2,3H3/b7-6+.
What are the key properties of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one?
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one has a molecular weight of 351.40 g/mol, XLogP of 4.12, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-pyridin-4-ylprop-2-en-1-one is sourced from PubChem (CID 25133922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).