About (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one (PubChem CID 25133923) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| PubChem CID | 25133923 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| SMILES | C=CCOc1cc(OC)c(C(=O)/C=C/c2ccc[nH]2)c(OCC=C)c1 |
| InChI | InChI=1S/C20H21NO4/c1-4-11-24-16-13-18(23-3)20(19(14-16)25-12-5-2)17(22)9-8-15-7-6-10-21-15/h4-10,13-14,21H,1-2,11-12H2,3H3/b9-8+ |
| InChIKey | GAXGLTYOIYYPMV-CMDGGOBGSA-N |
| XLogP | 4.05 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one?
The IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one (CID 25133923) is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one?
The canonical SMILES for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one is C=CCOc1cc(OC)c(C(=O)/C=C/c2ccc[nH]2)c(OCC=C)c1.
What is the InChIKey of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one?
The InChIKey is GAXGLTYOIYYPMV-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H21NO4/c1-4-11-24-16-13-18(23-3)20(19(14-16)25-12-5-2)17(22)9-8-15-7-6-10-21-15/h4-10,13-14,21H,1-2,11-12H2,3H3/b9-8+.
What are the key properties of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one?
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one has a molecular weight of 339.39 g/mol, XLogP of 4.05, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one is sourced from PubChem (CID 25133923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).