C27H35N5O4S — CID 25134149
3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N-(2-methoxyethyl)-N,1-dimethylindole-5-carboxamide (PubChem CID 25134149) has the molecular formula C27H35N5O4S and a molecular weight of 525.68 g/mol. Its IUPAC name is 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N-(2-methoxyethyl)-N,1-dimethylindole-5-carboxamide.
| Compound Name | 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N-(2-methoxyethyl)-N,1-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 25134149 |
| Molecular Formula | C27H35N5O4S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N-(2-methoxyethyl)-N,1-dimethylindole-5-carboxamide |
| SMILES | COCCN(C)C(=O)c1ccc2c(c1)c(C[C@H]1COCCN1c1nc3c(s1)C(=O)NC(C)(C)C3)cn2C |
| InChI | InChI=1S/C27H35N5O4S/c1-27(2)14-21-23(24(33)29-27)37-26(28-21)32-9-11-36-16-19(32)12-18-15-31(4)22-7-6-17(13-20(18)22)25(34)30(3)8-10-35-5/h6-7,13,15,19H,8-12,14,16H2,1-5H3,(H,29,33)/t19-/m0/s1 |
| InChIKey | IFSNARYYAQCALM-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |