C25H31N5O3S — CID 25134159
3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N,N,1-trimethylindole-5-carboxamide (PubChem CID 25134159) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N,N,1-trimethylindole-5-carboxamide.
| Compound Name | 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N,N,1-trimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 25134159 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[[(3S)-4-(6,6-dimethyl-4-oxo-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholin-3-yl]methyl]-N,N,1-trimethylindole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)c(C[C@H]1COCCN1c1nc3c(s1)C(=O)NC(C)(C)C3)cn2C |
| InChI | InChI=1S/C25H31N5O3S/c1-25(2)12-19-21(22(31)27-25)34-24(26-19)30-8-9-33-14-17(30)10-16-13-29(5)20-7-6-15(11-18(16)20)23(32)28(3)4/h6-7,11,13,17H,8-10,12,14H2,1-5H3,(H,27,31)/t17-/m0/s1 |
| InChIKey | JVSGBNZVDWHFDO-KRWDZBQOSA-N |
| XLogP | 2.85 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |