C16H24N2OS — CID 25134249
N-(1-benzylpiperidin-4-yl)-4-sulfanylbutanamide (PubChem CID 25134249) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-sulfanylbutanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 25134249 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-sulfanylbutanamide |
| SMILES | O=C(CCCS)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2OS/c19-16(7-4-12-20)17-15-8-10-18(11-9-15)13-14-5-2-1-3-6-14/h1-3,5-6,15,20H,4,7-13H2,(H,17,19) |
| InChIKey | XNIXPLIQGKQSIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|