C12H19N3O7S3 — CID 25134300
3-[(4S,6S)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]propyl nitrate (PubChem CID 25134300) has the molecular formula C12H19N3O7S3 and a molecular weight of 413.50 g/mol. Its IUPAC name is 3-[(4S,6S)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]propyl nitrate.
| Compound Name | 3-[(4S,6S)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]propyl nitrate |
|---|---|
| PubChem CID | 25134300 |
| Molecular Formula | C12H19N3O7S3 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-[(4S,6S)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]propyl nitrate |
| SMILES | CCN[C@H]1C[C@H](CCCO[N+](=O)[O-])S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C12H19N3O7S3/c1-2-14-10-6-8(4-3-5-22-15(16)17)24(18,19)12-9(10)7-11(23-12)25(13,20)21/h7-8,10,14H,2-6H2,1H3,(H2,13,20,21)/t8-,10-/m0/s1 |
| InChIKey | HBAOYBZXIZJLNQ-WPRPVWTQSA-N |
| XLogP | 0.58 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|