C23H16N4O2 — CID 25134547
3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 25134547) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 25134547 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(c1nc3c4cccnc4c4ncccc4c3[nH]1)CO2 |
| InChI | InChI=1S/C23H16N4O2/c1-12-6-7-17-15(10-12)22(28)16(11-29-17)23-26-20-13-4-2-8-24-18(13)19-14(21(20)27-23)5-3-9-25-19/h2-10,16H,11H2,1H3,(H,26,27) |
| InChIKey | IZBILMFLFGTTPW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|