About [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate
[3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (PubChem CID 25135301) has the molecular formula C20H25NO5
and a molecular weight of 359.42 g/mol. Its IUPAC name is [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| PubChem CID | 25135301 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)NC12CCC(O)CC2 |
| InChI | InChI=1S/C20H25NO5/c1-4-25-19(24)26-17-16(15-11-12(2)5-6-13(15)3)18(23)21-20(17)9-7-14(22)8-10-20/h5-6,11,14,22H,4,7-10H2,1-3H3,(H,21,23) |
| InChIKey | JHHBWESLEWKHFK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The IUPAC name of [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (CID 25135301) is [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
What is the SMILES notation for [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The canonical SMILES for [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)NC12CCC(O)CC2.
What is the InChIKey of [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The InChIKey is JHHBWESLEWKHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO5/c1-4-25-19(24)26-17-16(15-11-12(2)5-6-13(15)3)18(23)21-20(17)9-7-14(22)8-10-20/h5-6,11,14,22H,4,7-10H2,1-3H3,(H,21,23).
What are the key properties of [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
[3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate has a molecular weight of 359.42 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-dimethylphenyl)-8-hydroxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is sourced from PubChem (CID 25135301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).