C26H32Cl3NO3 — CID 25135531
[(1R,2R,3R,5R)-5-tert-butyl-3-(dibenzylamino)-2-hydroxycyclohexyl] 2,2,2-trichloroacetate (PubChem CID 25135531) has the molecular formula C26H32Cl3NO3 and a molecular weight of 512.91 g/mol. Its IUPAC name is [(1R,2R,3R,5R)-5-tert-butyl-3-(dibenzylamino)-2-hydroxycyclohexyl] 2,2,2-trichloroacetate.
| Compound Name | [(1R,2R,3R,5R)-5-tert-butyl-3-(dibenzylamino)-2-hydroxycyclohexyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 25135531 |
| Molecular Formula | C26H32Cl3NO3 |
| Molecular Weight | 512.91 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [(1R,2R,3R,5R)-5-tert-butyl-3-(dibenzylamino)-2-hydroxycyclohexyl] 2,2,2-trichloroacetate |
| SMILES | CC(C)(C)[C@@H]1C[C@@H](N(Cc2ccccc2)Cc2ccccc2)[C@@H](O)[C@H](OC(=O)C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C26H32Cl3NO3/c1-25(2,3)20-14-21(23(31)22(15-20)33-24(32)26(27,28)29)30(16-18-10-6-4-7-11-18)17-19-12-8-5-9-13-19/h4-13,20-23,31H,14-17H2,1-3H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | AYDHSVDNLBGUCP-SSGKUCQKSA-N |
| XLogP | 6.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.91 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|