C21H23N3O6 — CID 25135592
(2R,3R)-3-(6-azidohexoxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 25135592) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2R,3R)-3-(6-azidohexoxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-3-(6-azidohexoxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 25135592 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3R)-3-(6-azidohexoxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | [N-]=[N+]=NCCCCCCO[C@H]1C(=O)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H23N3O6/c22-24-23-9-3-1-2-4-10-29-21-19(28)18-16(27)11-15(26)12-17(18)30-20(21)13-5-7-14(25)8-6-13/h5-8,11-12,20-21,25-27H,1-4,9-10H2/t20-,21+/m1/s1 |
| InChIKey | RABYBFDTLWZUPD-RTWAWAEBSA-N |
| XLogP | 4.38 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|