C32H30N2O2 — CID 25135723
ethyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 25135723) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is ethyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25135723 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | ethyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)C[C@@H](c2ccccc2)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H30N2O2/c1-2-36-32(35)30-28(33-26-19-11-5-12-20-26)23-29(24-15-7-3-8-16-24)34(27-21-13-6-14-22-27)31(30)25-17-9-4-10-18-25/h3-22,29,31,33H,2,23H2,1H3/t29-,31+/m0/s1 |
| InChIKey | VIHQGHFBJQEGJJ-IGYGKHONSA-N |
| XLogP | 7.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |