C34H34N2O2 — CID 25135724
tert-butyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 25135724) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25135724 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | tert-butyl (2S,6R)-4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(Nc2ccccc2)C[C@@H](c2ccccc2)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H34N2O2/c1-34(2,3)38-33(37)31-29(35-27-20-12-6-13-21-27)24-30(25-16-8-4-9-17-25)36(28-22-14-7-15-23-28)32(31)26-18-10-5-11-19-26/h4-23,30,32,35H,24H2,1-3H3/t30-,32+/m0/s1 |
| InChIKey | NYVFGIAVIORZTJ-XDFJSJKPSA-N |
| XLogP | 8.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |