C29H40N2O2 — CID 25135838
methyl (2S,6R)-1-butyl-4-(butylamino)-2,6-bis(4-methylphenyl)-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 25135838) has the molecular formula C29H40N2O2 and a molecular weight of 448.65 g/mol. Its IUPAC name is methyl (2S,6R)-1-butyl-4-(butylamino)-2,6-bis(4-methylphenyl)-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2S,6R)-1-butyl-4-(butylamino)-2,6-bis(4-methylphenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25135838 |
| Molecular Formula | C29H40N2O2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | methyl (2S,6R)-1-butyl-4-(butylamino)-2,6-bis(4-methylphenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCCCNC1=C(C(=O)OC)[C@@H](c2ccc(C)cc2)N(CCCC)[C@H](c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C29H40N2O2/c1-6-8-18-30-25-20-26(23-14-10-21(3)11-15-23)31(19-9-7-2)28(27(25)29(32)33-5)24-16-12-22(4)13-17-24/h10-17,26,28,30H,6-9,18-20H2,1-5H3/t26-,28+/m0/s1 |
| InChIKey | NHFDTTXZPIQYGX-XTEPFMGCSA-N |
| XLogP | 6.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|