About CID 25135916
CID 25135916 (PubChem CID 25135916) has the molecular formula C19H13BrO3
and a molecular weight of 369.21 g/mol.
Molecular Properties
| Compound Name | CID 25135916 |
| PubChem CID | 25135916 |
| Molecular Formula | C19H13BrO3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | — |
| SMILES | O=C1C=CC2(Oc3cccc4c(Br)ccc(c34)O2)C12C=CCC2 |
| InChI | InChI=1S/C19H13BrO3/c20-13-6-7-15-17-12(13)4-3-5-14(17)22-19(23-15)11-8-16(21)18(19)9-1-2-10-18/h1,3-9,11H,2,10H2 |
| InChIKey | KZFHPUFRRBYWFO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 25135916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25135916?
The IUPAC name of CID 25135916 (CID 25135916) is not available.
What is the SMILES notation for CID 25135916?
The canonical SMILES for CID 25135916 is O=C1C=CC2(Oc3cccc4c(Br)ccc(c34)O2)C12C=CCC2.
What is the InChIKey of CID 25135916?
The InChIKey is KZFHPUFRRBYWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrO3/c20-13-6-7-15-17-12(13)4-3-5-14(17)22-19(23-15)11-8-16(21)18(19)9-1-2-10-18/h1,3-9,11H,2,10H2.
What are the key properties of CID 25135916?
CID 25135916 has a molecular weight of 369.21 g/mol, XLogP of 4.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25135916 is sourced from PubChem (CID 25135916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).