About (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one
(6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one (PubChem CID 25135923) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one.
Molecular Properties
| Compound Name | (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one |
| PubChem CID | 25135923 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one |
| SMILES | CCCC[C@]1([C@@H](O)CO)CCCC(=O)O1 |
| InChI | InChI=1S/C11H20O4/c1-2-3-6-11(9(13)8-12)7-4-5-10(14)15-11/h9,12-13H,2-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | BGQWFCALUHVWLJ-GXSJLCMTSA-N |
| XLogP | 1.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one?
The IUPAC name of (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one (CID 25135923) is (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one.
What is the SMILES notation for (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one?
The canonical SMILES for (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one is CCCC[C@]1([C@@H](O)CO)CCCC(=O)O1.
What is the InChIKey of (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one?
The InChIKey is BGQWFCALUHVWLJ-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-3-6-11(9(13)8-12)7-4-5-10(14)15-11/h9,12-13H,2-8H2,1H3/t9-,11+/m0/s1.
What are the key properties of (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one?
(6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one has a molecular weight of 216.28 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-butyl-6-[(1S)-1,2-dihydroxyethyl]oxan-2-one is sourced from PubChem (CID 25135923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).