C32H50O9 — CID 25135937
[(1R,2S,3aR,4S,5aR,6S,7S,8S,10aR,10bS)-4,8-diacetyloxy-6-butanoyloxy-7-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate (PubChem CID 25135937) has the molecular formula C32H50O9 and a molecular weight of 578.74 g/mol. Its IUPAC name is [(1R,2S,3aR,4S,5aR,6S,7S,8S,10aR,10bS)-4,8-diacetyloxy-6-butanoyloxy-7-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate.
| Compound Name | [(1R,2S,3aR,4S,5aR,6S,7S,8S,10aR,10bS)-4,8-diacetyloxy-6-butanoyloxy-7-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate |
|---|---|
| PubChem CID | 25135937 |
| Molecular Formula | C32H50O9 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | [(1R,2S,3aR,4S,5aR,6S,7S,8S,10aR,10bS)-4,8-diacetyloxy-6-butanoyloxy-7-hydroxy-3a,5a,9-trimethyl-1-propan-2-yl-1,2,3,4,5,6,7,8,10a,10b-decahydrocyclohepta[e]inden-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@]2(C)[C@H]([C@H]1C(C)C)[C@H]1C=C(C)[C@H](OC(C)=O)[C@H](O)[C@@H](OC(=O)CCC)[C@]1(C)C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C32H50O9/c1-10-12-24(35)40-22-15-32(9)23(38-19(6)33)16-31(8)21(27(32)26(22)17(3)4)14-18(5)29(39-20(7)34)28(37)30(31)41-25(36)13-11-2/h14,17,21-23,26-30,37H,10-13,15-16H2,1-9H3/t21-,22+,23+,26+,27+,28+,29+,30-,31-,32+/m1/s1 |
| InChIKey | PZBZPMVERFDPDD-AQEUHLRASA-N |
| XLogP | 4.92 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|