C35H34N2O2 — CID 25135966
prop-2-enyl (2S,6R)-4-anilino-2,6-bis(4-methylphenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 25135966) has the molecular formula C35H34N2O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is prop-2-enyl (2S,6R)-4-anilino-2,6-bis(4-methylphenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | prop-2-enyl (2S,6R)-4-anilino-2,6-bis(4-methylphenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25135966 |
| Molecular Formula | C35H34N2O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | prop-2-enyl (2S,6R)-4-anilino-2,6-bis(4-methylphenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | C=CCOC(=O)C1=C(Nc2ccccc2)C[C@@H](c2ccc(C)cc2)N(c2ccccc2)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C35H34N2O2/c1-4-23-39-35(38)33-31(36-29-11-7-5-8-12-29)24-32(27-19-15-25(2)16-20-27)37(30-13-9-6-10-14-30)34(33)28-21-17-26(3)18-22-28/h4-22,32,34,36H,1,23-24H2,2-3H3/t32-,34+/m0/s1 |
| InChIKey | PZOWAEUENBVOFJ-UZNNEEJFSA-N |
| XLogP | 8.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|