C29H42O5 — CID 25136075
methyl 2-[5-hydroxy-2-[(6E,13E)-12-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,13,15-tetraen-3-yl]oxyphenyl]acetate (PubChem CID 25136075) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is methyl 2-[5-hydroxy-2-[(6E,13E)-12-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,13,15-tetraen-3-yl]oxyphenyl]acetate.
| Compound Name | methyl 2-[5-hydroxy-2-[(6E,13E)-12-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,13,15-tetraen-3-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 25136075 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | methyl 2-[5-hydroxy-2-[(6E,13E)-12-hydroxy-3,7,11,15-tetramethylhexadeca-1,6,13,15-tetraen-3-yl]oxyphenyl]acetate |
| SMILES | C=CC(C)(CC/C=C(\C)CCCC(C)C(O)/C=C/C(=C)C)Oc1ccc(O)cc1CC(=O)OC |
| InChI | InChI=1S/C29H42O5/c1-8-29(6,34-27-17-15-25(30)19-24(27)20-28(32)33-7)18-10-12-22(4)11-9-13-23(5)26(31)16-14-21(2)3/h8,12,14-17,19,23,26,30-31H,1-2,9-11,13,18,20H2,3-7H3/b16-14+,22-12+ |
| InChIKey | RKZJVJMWRATIOY-OYKAJTBBSA-N |
| XLogP | 6.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|