C24H18N2O4S — CID 25136434
(1S,3S)-3-(4-nitrophenyl)-1-phenylsulfanyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one (PubChem CID 25136434) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is (1S,3S)-3-(4-nitrophenyl)-1-phenylsulfanyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one.
| Compound Name | (1S,3S)-3-(4-nitrophenyl)-1-phenylsulfanyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 25136434 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (1S,3S)-3-(4-nitrophenyl)-1-phenylsulfanyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one |
| SMILES | O=c1oc2ccccc2c2c1N[C@H](c1ccc([N+](=O)[O-])cc1)C[C@@H]2Sc1ccccc1 |
| InChI | InChI=1S/C24H18N2O4S/c27-24-23-22(18-8-4-5-9-20(18)30-24)21(31-17-6-2-1-3-7-17)14-19(25-23)15-10-12-16(13-11-15)26(28)29/h1-13,19,21,25H,14H2/t19-,21-/m0/s1 |
| InChIKey | PHTQOZXJVRYLLW-FPOVZHCZSA-N |
| XLogP | 6.09 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|