C25H31NO8S2 — CID 25136595
ethyl (1S,2S,7R,8R,9S)-4-(2-acetyloxyethyl)-9-ethoxy-5-methyl-1-[(S)-(4-methylphenyl)sulfinyl]-11-oxo-10-oxa-3-thia-6-azatricyclo[6.3.0.02,6]undec-4-ene-7-carboxylate (PubChem CID 25136595) has the molecular formula C25H31NO8S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is ethyl (1S,2S,7R,8R,9S)-4-(2-acetyloxyethyl)-9-ethoxy-5-methyl-1-[(S)-(4-methylphenyl)sulfinyl]-11-oxo-10-oxa-3-thia-6-azatricyclo[6.3.0.02,6]undec-4-ene-7-carboxylate.
| Compound Name | ethyl (1S,2S,7R,8R,9S)-4-(2-acetyloxyethyl)-9-ethoxy-5-methyl-1-[(S)-(4-methylphenyl)sulfinyl]-11-oxo-10-oxa-3-thia-6-azatricyclo[6.3.0.02,6]undec-4-ene-7-carboxylate |
|---|---|
| PubChem CID | 25136595 |
| Molecular Formula | C25H31NO8S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | ethyl (1S,2S,7R,8R,9S)-4-(2-acetyloxyethyl)-9-ethoxy-5-methyl-1-[(S)-(4-methylphenyl)sulfinyl]-11-oxo-10-oxa-3-thia-6-azatricyclo[6.3.0.02,6]undec-4-ene-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@@H](OCC)OC(=O)[C@]2([S@@](=O)c2ccc(C)cc2)[C@@H]2SC(CCOC(C)=O)=C(C)N21 |
| InChI | InChI=1S/C25H31NO8S2/c1-6-31-21(28)20-19-22(32-7-2)34-24(29)25(19,36(30)17-10-8-14(3)9-11-17)23-26(20)15(4)18(35-23)12-13-33-16(5)27/h8-11,19-20,22-23H,6-7,12-13H2,1-5H3/t19-,20-,22+,23+,25-,36+/m1/s1 |
| InChIKey | SFGUIDOQTGHOPP-NBZOPQEWSA-N |
| XLogP | 2.88 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|