About 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene
3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene (PubChem CID 25136706) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene.
Molecular Properties
| Compound Name | 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene |
| PubChem CID | 25136706 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene |
| SMILES | C=C1CC(OC)CC(C)(C)C12CC=C(C)CC2 |
| InChI | InChI=1S/C16H26O/c1-12-6-8-16(9-7-12)13(2)10-14(17-5)11-15(16,3)4/h6,14H,2,7-11H2,1,3-5H3 |
| InChIKey | YKCFVSRFRRFSSQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The IUPAC name of 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene (CID 25136706) is 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene.
What is the SMILES notation for 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The canonical SMILES for 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene is C=C1CC(OC)CC(C)(C)C12CC=C(C)CC2.
What is the InChIKey of 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
The InChIKey is YKCFVSRFRRFSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-12-6-8-16(9-7-12)13(2)10-14(17-5)11-15(16,3)4/h6,14H,2,7-11H2,1,3-5H3.
What are the key properties of 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene?
3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene has a molecular weight of 234.38 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-ene is sourced from PubChem (CID 25136706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).