C22H32O6 — CID 25136791
(2S,3R,4S,5R)-2-[[2-hydroxy-5-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol (PubChem CID 25136791) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[[2-hydroxy-5-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[[2-hydroxy-5-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 25136791 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2S,3R,4S,5R)-2-[[2-hydroxy-5-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C)=CCCCC1CCCc2c1ccc(O)c2O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H32O6/c1-13(2)6-3-4-7-14-8-5-9-16-15(14)10-11-17(23)21(16)28-22-20(26)19(25)18(24)12-27-22/h6,10-11,14,18-20,22-26H,3-5,7-9,12H2,1-2H3/t14?,18-,19+,20-,22+/m1/s1 |
| InChIKey | MKNQXWVOQDXIIY-ZSDFJTCZSA-N |
| XLogP | 2.77 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|