About 3-bromo-2,4,6-trimethylpyridine
3-bromo-2,4,6-trimethylpyridine (PubChem CID 25136843) has the molecular formula C8H10BrN
and a molecular weight of 200.08 g/mol. Its IUPAC name is 3-bromo-2,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | 3-bromo-2,4,6-trimethylpyridine |
| PubChem CID | 25136843 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 3-bromo-2,4,6-trimethylpyridine |
| SMILES | Cc1cc(C)c(Br)c(C)n1 |
| InChI | InChI=1S/C8H10BrN/c1-5-4-6(2)10-7(3)8(5)9/h4H,1-3H3 |
| InChIKey | HDIJRNSEQXUVPU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4,6-trimethylpyridine?
The IUPAC name of 3-bromo-2,4,6-trimethylpyridine (CID 25136843) is 3-bromo-2,4,6-trimethylpyridine.
What is the SMILES notation for 3-bromo-2,4,6-trimethylpyridine?
The canonical SMILES for 3-bromo-2,4,6-trimethylpyridine is Cc1cc(C)c(Br)c(C)n1.
What is the InChIKey of 3-bromo-2,4,6-trimethylpyridine?
The InChIKey is HDIJRNSEQXUVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN/c1-5-4-6(2)10-7(3)8(5)9/h4H,1-3H3.
What are the key properties of 3-bromo-2,4,6-trimethylpyridine?
3-bromo-2,4,6-trimethylpyridine has a molecular weight of 200.08 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4,6-trimethylpyridine is sourced from PubChem (CID 25136843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).