C14H15F7O — CID 25137230
1,1,1,2,2,3,3-heptafluoro-8-phenyloctan-4-ol (PubChem CID 25137230) has the molecular formula C14H15F7O and a molecular weight of 332.26 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-8-phenyloctan-4-ol.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-8-phenyloctan-4-ol |
|---|---|
| PubChem CID | 25137230 |
| Molecular Formula | C14H15F7O |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-8-phenyloctan-4-ol |
| SMILES | OC(CCCCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F7O/c15-12(16,13(17,18)14(19,20)21)11(22)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7,11,22H,4-5,8-9H2 |
| InChIKey | JTXDZUWPNVVKQF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|