C13H15F5O — CID 25137233
1,1,1,2,2-pentafluoro-7-phenylheptan-3-ol (PubChem CID 25137233) has the molecular formula C13H15F5O and a molecular weight of 282.25 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-7-phenylheptan-3-ol.
| Compound Name | 1,1,1,2,2-pentafluoro-7-phenylheptan-3-ol |
|---|---|
| PubChem CID | 25137233 |
| Molecular Formula | C13H15F5O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-7-phenylheptan-3-ol |
| SMILES | OC(CCCCc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F5O/c14-12(15,13(16,17)18)11(19)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7,11,19H,4-5,8-9H2 |
| InChIKey | HHZIIDOKDSVKRG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|