C15H17N3O2 — CID 25137542
3-[(4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-4-hydroxybenzonitrile (PubChem CID 25137542) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[(4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-4-hydroxybenzonitrile.
| Compound Name | 3-[(4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 25137542 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 3-[(4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)c(C2N[C@H]3CCCC[C@@H]3NC2=O)c1 |
| InChI | InChI=1S/C15H17N3O2/c16-8-9-5-6-13(19)10(7-9)14-15(20)18-12-4-2-1-3-11(12)17-14/h5-7,11-12,14,17,19H,1-4H2,(H,18,20)/t11-,12-,14?/m0/s1 |
| InChIKey | OUTLRVVDLBNELS-VHBIQUBJSA-N |
| XLogP | 1.34 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|