C24H50O7Si2 — CID 25137601
ethyl (E,4R,5R,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxy-4-(2-hydroxyethyl)oct-2-enoate (PubChem CID 25137601) has the molecular formula C24H50O7Si2 and a molecular weight of 506.83 g/mol. Its IUPAC name is ethyl (E,4R,5R,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxy-4-(2-hydroxyethyl)oct-2-enoate.
| Compound Name | ethyl (E,4R,5R,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxy-4-(2-hydroxyethyl)oct-2-enoate |
|---|---|
| PubChem CID | 25137601 |
| Molecular Formula | C24H50O7Si2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | ethyl (E,4R,5R,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxy-4-(2-hydroxyethyl)oct-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@](O)(CCO)[C@H](O)C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O7Si2/c1-12-29-21(27)13-14-24(28,15-16-25)20(26)17-19(31-33(10,11)23(5,6)7)18-30-32(8,9)22(2,3)4/h13-14,19-20,25-26,28H,12,15-18H2,1-11H3/b14-13+/t19-,20-,24+/m1/s1 |
| InChIKey | LAMGKTOTDPFARJ-LKHIJISUSA-N |
| XLogP | 4.38 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|