C32H62O8Si2 — CID 25137605
(2R,3S)-3-[(2R,3S,4R,5R,6S)-5-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyoxan-2-yl]-3-hydroxy-2-methylpropanoic acid (PubChem CID 25137605) has the molecular formula C32H62O8Si2 and a molecular weight of 631.01 g/mol. Its IUPAC name is (2R,3S)-3-[(2R,3S,4R,5R,6S)-5-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyoxan-2-yl]-3-hydroxy-2-methylpropanoic acid.
| Compound Name | (2R,3S)-3-[(2R,3S,4R,5R,6S)-5-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyoxan-2-yl]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 25137605 |
| Molecular Formula | C32H62O8Si2 |
| Molecular Weight | 631.01 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | (2R,3S)-3-[(2R,3S,4R,5R,6S)-5-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyoxan-2-yl]-3-hydroxy-2-methylpropanoic acid |
| SMILES | CCCC[C@@H](/C=C/C(=O)O[C@@H]1[C@@H](C)[C@H](O[Si](CC)(CC)CC)[C@@](C)([C@@H](O)[C@@H](C)C(=O)O)O[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62O8Si2/c1-14-18-19-25(39-41(12,13)31(8,9)10)20-21-26(33)37-27-22(5)29(40-42(15-2,16-3)17-4)32(11,38-24(27)7)28(34)23(6)30(35)36/h20-25,27-29,34H,14-19H2,1-13H3,(H,35,36)/b21-20+/t22-,23-,24+,25+,27-,28+,29+,32-/m1/s1 |
| InChIKey | NIQLXEIVQYWDQN-XULMHMJCSA-N |
| XLogP | 7.32 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.01 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|