C33H64O8Si2 — CID 25137606
[(2S,3R,4R,5S,6R)-6-[(1S,2R)-1-hydroxy-3-methoxy-2-methyl-3-oxopropyl]-2,4,6-trimethyl-5-triethylsilyloxyoxan-3-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate (PubChem CID 25137606) has the molecular formula C33H64O8Si2 and a molecular weight of 645.04 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-6-[(1S,2R)-1-hydroxy-3-methoxy-2-methyl-3-oxopropyl]-2,4,6-trimethyl-5-triethylsilyloxyoxan-3-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate.
| Compound Name | [(2S,3R,4R,5S,6R)-6-[(1S,2R)-1-hydroxy-3-methoxy-2-methyl-3-oxopropyl]-2,4,6-trimethyl-5-triethylsilyloxyoxan-3-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
|---|---|
| PubChem CID | 25137606 |
| Molecular Formula | C33H64O8Si2 |
| Molecular Weight | 645.04 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-6-[(1S,2R)-1-hydroxy-3-methoxy-2-methyl-3-oxopropyl]-2,4,6-trimethyl-5-triethylsilyloxyoxan-3-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
| SMILES | CCCC[C@@H](/C=C/C(=O)O[C@@H]1[C@@H](C)[C@H](O[Si](CC)(CC)CC)[C@@](C)([C@@H](O)[C@@H](C)C(=O)OC)O[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64O8Si2/c1-15-19-20-26(40-42(13,14)32(8,9)10)21-22-27(34)38-28-23(5)30(41-43(16-2,17-3)18-4)33(11,39-25(28)7)29(35)24(6)31(36)37-12/h21-26,28-30,35H,15-20H2,1-14H3/b22-21+/t23-,24-,25+,26+,28-,29+,30+,33-/m1/s1 |
| InChIKey | GJBJCMOMJQVGIQ-SSRIRBMOSA-N |
| XLogP | 7.41 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.04 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|