C56H52N4Zn — CID 25137917
zinc 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide (PubChem CID 25137917) has the molecular formula C56H52N4Zn and a molecular weight of 846.45 g/mol. Its IUPAC name is zinc 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 25137917 |
| Molecular Formula | C56H52N4Zn |
| Molecular Weight | 846.45 g/mol |
| Exact Mass | 844.35 |
| IUPAC Name | zinc 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C56H52N4.Zn/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10;/h13-28H,1-12H3;/q-2;+2/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+; |
| InChIKey | XVBBVBUMPPXULW-XYIYAAJRSA-N |
| XLogP | 14.28 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.45 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|