C20H15N5O3S — CID 25138000
N-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]phenyl]pyridine-3-carboxamide (PubChem CID 25138000) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is N-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25138000 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]phenyl]pyridine-3-carboxamide |
| SMILES | NC(=O)Nc1sc(C#Cc2cccc(NC(=O)c3cccnc3)c2)cc1C(N)=O |
| InChI | InChI=1S/C20H15N5O3S/c21-17(26)16-10-15(29-19(16)25-20(22)28)7-6-12-3-1-5-14(9-12)24-18(27)13-4-2-8-23-11-13/h1-5,8-11H,(H2,21,26)(H,24,27)(H3,22,25,28) |
| InChIKey | MIJOKSLSGLAPBZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|